|
|
|
Note 1: B60040-B60381 are substances that are approved as food additives prescribed in the Food Hygiene Law.(partly including inorganic substances) Note 2: It is a premise that B60040-B60381 do not change their nature in water before and after a boiling point or in hot oil before and after 180 degree of C. Therefore, substances, that change their nature at the molding temperature of Class A substances and that have possibilities to react with Class A substances and other components, are to be deliverated one by one. Note 3: The upper limit of use in a product is to be delivered one by one on the same principle as are applied to other additives. |
|
PL# |
Substance Name/PL Name/Chemical Formula/Official Gazette No./CAS No. |
○: Food Additive |
Comments |
||||
|
Substance Name |
PL Name |
Chemical Formula |
Official Gazette No. |
CAS No. |
Limitation of Use(Food additive to describe limitation based on Food Sanitation Law) |
||
|
B60040 |
Ester gum |
Ester gum |
|
|
|
○ |
|
|
B60089 |
Glycerol |
Glycerol |
|
|
|
○ |
|
|
B60090 |
Glycerine fatty acid ester |
Glycerine fatty acid ester |
|
|
|
○ |
|
|
B60117 |
Acetic acid |
Acetic acid |
|
|
|
○ |
|
|
B60151 |
Fatty acids |
Fatty acids |
|
|
|
○ |
|
|
B60170 |
Food red No.102 (New Coccine) |
Food red No.102 (New Coccine) |
|
|
|
○ |
|
|
B60175 |
Food yellow No.4 Aluminium Lake |
Food yellow No.4 Aluminium Lake |
|
|
|
○ |
|
|
B60177 |
Food yellow No.5 Aluminium Lake |
Food yellow No.5 Aluminium Lake |
|
|
|
○ |
|
|
B60180 |
Food blue No.1 (Brilliant Blue FCF) |
Food blue No.1 (Brilliant Blue FCF) |
|
|
|
○ |
|
|
B60181 |
Food blue No.1 Aluminium Lake |
Food blue No.1 Aluminium Lake |
|
|
|
○ |
|
|
B60205 |
Calcium carbonate |
Calcium carbonate |
|
|
|
○ |
1.0% as Calcium |
|
B60224 |
Sodium iron chlorophyllin |
Sodium iron chlorophyllin |
|
|
|
○ |
|
|
B60246 |
Calcium lactate |
Calcium lactate |
|
|
|
○ |
1.0% as Calcium |
|
B60315 |
Sodium polyacrylate |
Sodium polyacrylate |
|
|
|
○ |
0.20% |
|
B60349 |
Riboflavine (Vitamin B2) |
Riboflavine (Vitamin B2) |
|
|
|
○ |
|
|
B60358 |
Ferrous sulfate
(Dry) ( |
Ferrous sulfate
(Dry) ( |
|
|
|
○ |
|
|
B60360 |
Sodium sulfate |
Sodium sulfate |
|
|
|
○ |
|
|
B60361 |
Magnesium sulfate |
Magnesium sulfate |
|
|
|
○ |
|
|
B60362 |
Liquid paraffin |
Liquid paraffin |
|
|
|
○ |
Max. residual amount 0.10% |
|
B60365 |
Phosphoric acid |
Phosphoric acid |
|
|
|
○ |
|
|
B60377 |
Lecithin |
Lecithin |
|
|
|
○ |
|
|
B60381 |
Talc |
Talc |
|
|
|
○ |
Max. residual amount: 0.50% |
|
|
|||||||
|
B60400 |
Hydroxypropylether starch (including ydrolyzed starch and oxidized starch) |
Hydroxypropylether starch (including ydrolyzed starch and oxidized starch) |
(C6H10O5)X(C2H4O)Y |
8-106 |
- |
◯ |
<50wt% |
|
B60401 |
Isothiazolon chloride/isothiazolon mixture |
Isothiazolon chloride/isothiazolon mixture |
*-C(X)=CH-C(=O)-N®-S-*,X;Cl/H |
- |
- |
|
<1wt.% |
|
B60402 |
Triacetylglycerine |
Triacetine |
C9H14O6 |
2-753 |
102-76-1 |
|
<1wt.% |
|
B60402(2) |
Mixture of glycerine acetic acid fatty acid and glycerine acetic acid ester |
Rikemar PL-3000 |
C6H5O6(CH3)n(C7H15)m |
2-2541,2-753 |
102-76-1 |
|
<1wt.% |
|
B60403 |
Di-tert-butylperoxide |
PERBUTYL D |
C8H18O2 |
2-367 |
110-05-4 |
|
<1wt.% |
|
B60404 |
Adipic acid di(butoxyethoxyethyl) diester |
Adipic acid di(butoxyethoxyethyl) diester |
C22H42O8 |
2-2565 |
141-17-3 |
|
|
|
B60404(2) |
Adipic acid diester |
Adekasizer-RS-107 |
(CH2)2(CH2COOC2H4OC2H4OC4H9)2 |
2-2565 |
141-17-3 |
|
|
|
B60405 |
Cresyl diphenylphosphate |
Cresyl diphenylphosphate |
(C6H5)2(CH3C6H4)O4P |
3-2620 |
26444-49 |
|
<1wt.% |
|
|
|||||||
|
B60406 |
Polycaprolactonetriol |
Celgreen 3058 |
Ｒ-{O［CO(CH2)5O］nH}3 |
7-808 |
37625-56-2 |
|
|
|
B60407 |
Polyesterpolyester blockcopolymer |
Perprene S1002 |
［COC6H4COO(CH2)4O］n[(CO(CH2)O)n]m |
7-1888 |
59544-42-2 |
|
<1wt.% |
|
B60408 |
Dimethylsiloxane |
Silicone resin |
(H3C)3SiO[Si(CH3)2O]nSi(CH3)3 |
7-476 |
63148-61-8 |
◯ |
<1wt.% |
|
B60409 |
Citric acid tributylacetate |
ATBC |
C20H34O8 |
2-1327 |
77-90-7 |
|
|
|
B60410 |
Hydroxyethylcellulose |
Hydroxyethylcellulose |
(C6H10O5)X(C2H4O)Y |
8-194 |
9004-62-0 |
|
<1wt.% |
|
|
|||||||
|
B60413 |
Glycerine monofatty acid |
Glycerine monofatty acid |
|
|
|
|
<1wt.% |
|
B60414 |
Glycerine acetic fatty acid ester |
Glycerine acetic fatty acid ester |
C15H26O6 |
2-2541 |
|
◯ |
|
|
B60415 |
Adipic acid di (methoxyethoxyethyl) diester |
Adipic acid di (methoxyethoxyethyl) diester |
C16H30O8 |
|
|
|
|
|
|
|||||||
|
B60416 |
Diisodecyl adipate |
Diisodecyl adipate (DADA) |
(CH2)4(COOC10H21)2 |
2-861 |
27178-16-1 |
|
<1wt.% |
|
B60417 |
Polyoxyethylene alkylether phosphate |
LTP2 |
[R-(CH2CH2O)2-O]3PO |
7-218 |
149919-05-1 |
|
<1wt.% |
|
B60418 |
Polyethylene glycol dibenzoate |
RIKAFLOW LA-100 |
C6H5CO-(O-C2H4-)nOCOC6H5 |
|
|
|
|
|
|
|||||||
|
B60421 |
2-Methyl-3(2H)-isothiazolone/1,2-Benzothiazoline-3-one |
LEBANAX BX-105 |
C4H5ONS/C7H5ONS mixture |
5-5235, 9-1845 |
|
|
<1wt.% |
|
B60422 |
1,2-ethanediyl 2-methyl-2-propenoate |
BLEMMER PDE-50 |
CH2=C(CH3)COOCH2CH2OCOC(CH3)=CH2 |
7-1056 |
97-90-5 |
|
<1wt.% |
|
B60423 |
Distearyl dimethyl ammonium chloride |
QUARTAMIN D86P |
|
|
61789-80-8 |
|
<1wt.% |
|
B60424 |
Cacao colour |
FLAMART |
|
|
|
◯ |
<1wt.% |
|
B60425 |
Xanthan gum |
Xanthan gum |
|
8-535 |
11138-66-2 |
◯ |
<1wt.% |
|
|
|||||||
|
B60426 |
Bis-(2-Ethylhexyl) nonanedioate |
DOZ |
(CH2)7(COOC8H17)2 |
2-879 |
103-24-2 |
|
<1wt.% |
|
B60427 |
Organosilane |
Trimethoxysilane delivative |
|
|
|
|
<1wt.% |
|
B60428 |
Polyisocyanate |
Modified XDI |
|
|
|
|
<1wt.% |
|
B60429 |
Polyisocyanate |
Modified IPDI |
|
|
|
|
<1wt.% |
|
B60430 |
Alpha-amylase |
LIQUOZYME SUPRA |
|
|
9000-90-2 |
|
<1wt.% |
|
[] |
|||||||
|
B60431 |
Urea |
Urea |
(NH2)2CO |
2-1732 |
57-13-6 |
|
|
|
B60432 |
Green
tea extract |
SUNPHENON |
|
|
|
|
<1wt.% |
|
B60433 |
Metal
salts of organic sulfonic acid |
LAK-301 |
|
|
|
|
<1wt.% |