|
GreenPla PL, Ver.2008.3(June) : Category Ｂ−３（Slipping Agent） |
|
ＰＬ＃ |
Substance Name/PL Name/Chemical Formula/Official Gazette No./CAS No |
Limitation of Use |
||||
|
Substance Name |
PL Name |
Chemical Formula |
Official Gazette No. |
CAS No. |
||
|
B30001 |
Epoxisized linseed oil fatty acid butyl ester |
Epoxisized linseed oil fatty acid butyl ester |
（Example:）CH3CH2(CHOCHCH2)2CHCH(CH2)7COO(CH2)3CH3 |
2-753 |
- |
|
|
B30002 |
Petroleum wax（ｎ-paraffin with max. C29） |
Petroleum wax（ｎ-paraffin with max. C29） |
CH3(CH2)nCH3, n≦27 |
2-10 (mixture) |
- |
>90% of n-Paraｆfin with max.C29 |
|
B30002(2) |
Petroleum wax（ｎ-paraffin with max. C48） |
|
CH3(CH2)nCH3, n≦48 |
|
|
|
|
B30002(3) |
Petroleum wax（ｎ-paraffin with
C50） |
|
CH3(CH2)nCH3, ｎ≧50 |
|
|
<1wt% |
|
B30003 |
Glycerol triacetate |
Glycerol triacetate |
(CH2OCOCH3)2CH2OCOCH3 |
|
102-76-1 |
|
|
B30005 |
Ethylpropionate |
Ethylpropionate |
C5H10O2 |
2-774 |
105-37-3 |
<1wt% |
|
|
||||||
|
B30007 |
Dimethyl sebacate |
Dimethyl sebacate |
C18H34O4 |
2-879 |
109-43-3 |
<1wt% |
|
B30008 |
Ethylene bis-stearyl amide |
Ethylene bis-stearyl amide |
C17H35CONHCH2CH2NHOCOC17H35 |
2-831 |
110-30-5 |
<1wt% |
|
B30009 |
Ethyl stearate |
Ethyl stearate |
C20H40O2 |
2-798 |
111-61-5 |
<1wt% |
|
B30010 |
Methyl oleate |
Methyl oleate |
C20H38O2 |
2-798 |
111-62-6 |
<1wt% |
|
|
||||||
|
B30011 |
Triethylene glycol |
Triethylene glycol |
C6H14O4 |
2-429 |
112-27-6 |
|
|
B30012 |
1-Dodecanol |
Lauryl alcohol |
C12H26O |
2-217 |
112-53-8 |
<1wt% |
|
B30013 |
1-Tetradecanol |
Myristyl alcohol |
C14H30O |
2-217 |
112-72-1 |
<1wt% |
|
B30014 |
Oleic acid |
Oleic acid |
C18H34O2 |
2-975 |
112-80-1 |
|
|
B30015 |
Erucyl amide （cis-13-Docosenoyl amide） |
Erucyl amide |
C21H41CONH2 |
2-824, 2-981 |
112-84-5 |
|
|
|
||||||
|
B30016 |
n-Stearyl alcohol |
n-Stearyl alcohol |
CH3(CH2)16CH2OH |
2-217 |
112-92-5 |
<1wt% |
|
B30016(2) |
1-Octadecanol |
n-Stearyl alcohol |
C18H38O |
2-217 |
112-92-5 |
<1wt% |
|
B30017 |
Pentaerythrytol tetrastearate |
Unistar H476 |
C77H148O8 |
2-649 |
115-83-3 |
<1wt% |
|
B30019 |
Ethyl caproate |
Ethyl caproate |
C8H16O2 |
2-782 |
123-66-0 |
<1wt% |
|
B30020 |
n-Butyl stearate |
n-Butyl stearate |
C22H44O2 |
2-798 |
123-95-5 |
<1wt% |
|
|
||||||
|
B30022 |
Stearyl amide |
Stearyl amide |
C17H35CONH2 |
2-824 |
124-26-5 |
<1wt% |
|
B30022(2) |
Stearyl amide |
Alflow S-10 |
C17H35CONH2 |
2-824 |
124-26-5 |
<1wt% |
|
B30022(3) |
Stearyl amide |
Amide ＡＰ−１ |
C17H35CONH2 |
2-824 |
124-26-5 |
|
|
B30023 |
Pentaerythrytol stearate |
Pentaerythrytol stearate |
C41H77O7 |
2-766 |
13081-97-5 |
<1wt% |
|
B30024 |
Methyl acetyllinolate |
Methyl acetyllinolate |
C21H38O4 |
2-1339 |
140-03-4 |
<1wt% |
|
B30024(2) |
Methyl acetyllinolate |
Methyl acetyllinolate |
C21H38O4 |
2-1339 |
140-03-4 |
<1wt% |
|
B30025 |
Fatty acid（C2〜C18)glycerides |
Fatty acid（C2〜C18)glycerides |
|
2-669 |
142-18-7 |
<1wt% |
|
|
||||||
|
B30027 |
Dodecanoic acid |
Lauric acid |
C12H24O2 |
2-608 |
143-07-7 |
<1wt% |
|
B30028 |
Calicium stearate |
Calicium stearate |
(C17H35COO)2Ca |
2-611 |
1592-23-0 |
<1wt% |
|
B30029 |
Polyesters of adipic acid/1,3-butylene glycol |
Polyesters of adipic acid/1,3-butylene glycol |
CH3CO[OC4H8OOC(CH2)4CO]nOC4H8OOCCH3 |
7-708,7-999 |
24937-93-7 |
|
|
B30030 |
Polypropylene glycol |
Polypropylene glycol |
C3H8O3 |
7-129 |
25332-69-4 |
<1wt% |
|
|
||||||
|
B30031 |
Montanic acid ester |
Montan wax |
C24-34 |
8-422 |
26787-65-5 |
<1wt% |
|
B30032 |
Stearyl stearate |
Rikemal SL-800 |
C36H72O2 |
2-2489 |
2778-96-3 |
<1wt% |
|
B30035 |
Oleyl amide |
Alflow E10 |
C17H33CONH2 |
2-824 |
301-02-0 |
<1wt% |
|
|
||||||
|
B30037 |
1-Hexanedecanol |
Palmityl alcohol |
C16H34O |
2-217 |
36653-82-4 |
<1wt% |
|
B30038 |
d-Sorbitol |
d-Sorbitol |
C6H14O6 |
8-50 |
50-70-4 |
<1wt% |
|
B30039 |
Myristic acid |
Myristic acid |
C14H28O2 |
2-608 |
544-63-8 |
<1wt% |
|
B30040 |
Magnesium stearate |
Magnesium stearate |
(C17H35COO)2Mg |
2-611 |
5557-04-0 |
<1wt% |
|
|
||||||
|
B30041 |
Glycerine |
Glycerine |
(C3H6O)n |
2-242 |
56-81-5 |
|
|
B30043 |
n-Amyl acetate |
n-Amyl acetate |
C7H14O2 |
2-733 |
628-63-7 |
<1wt% |
|
B30044 |
Dimethyl polysiloxane |
Dimethyl silicon |
CH3[(CH3)2SiO]n(CH3)3 |
7-476 |
63148-62-9 |
<1wt% |
|
B30045 |
Propyleneglycol fatty acid esters |
Propyleneglycol fatty acid esters |
|
2-772 |
67784-83-2 |
<1wt% |
|
|
||||||
|
B30046 |
Barium stearate |
Barium stearate |
(C17H35COO)2Ba |
2-611 |
||